About (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal
(E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal (PubChem CID 25217803) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal.
Molecular Properties
| Compound Name | (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal |
| PubChem CID | 25217803 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal |
| SMILES | COC1=C(C)C(=O)OC1C/C(C)=C/CCC(C)C=O |
| InChI | InChI=1S/C15H22O4/c1-10(6-5-7-11(2)9-16)8-13-14(18-4)12(3)15(17)19-13/h6,9,11,13H,5,7-8H2,1-4H3/b10-6+ |
| InChIKey | ZXPFLWBYGGQZJA-UXBLZVDNSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal?
The IUPAC name of (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal (CID 25217803) is (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal.
What is the SMILES notation for (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal?
The canonical SMILES for (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal is COC1=C(C)C(=O)OC1C/C(C)=C/CCC(C)C=O.
What is the InChIKey of (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal?
The InChIKey is ZXPFLWBYGGQZJA-UXBLZVDNSA-N. The full InChI is InChI=1S/C15H22O4/c1-10(6-5-7-11(2)9-16)8-13-14(18-4)12(3)15(17)19-13/h6,9,11,13H,5,7-8H2,1-4H3/b10-6+.
What are the key properties of (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal?
(E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal has a molecular weight of 266.34 g/mol, XLogP of 2.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-(3-methoxy-4-methyl-5-oxo-2H-furan-2-yl)-2,6-dimethylhept-5-enal is sourced from PubChem (CID 25217803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).