C27H29FN6O3S — CID 25217853
4-(3,5-dimethoxyphenyl)-N-ethyl-5-[2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (PubChem CID 25217853) has the molecular formula C27H29FN6O3S and a molecular weight of 536.63 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-N-ethyl-5-[2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine.
| Compound Name | 4-(3,5-dimethoxyphenyl)-N-ethyl-5-[2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 25217853 |
| Molecular Formula | C27H29FN6O3S |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-N-ethyl-5-[2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(-c2cc(OC)cc(OC)c2)c(-c2ccnc(Nc3ccc(N4CCOCC4)c(F)c3)n2)s1 |
| InChI | InChI=1S/C27H29FN6O3S/c1-4-29-27-33-24(17-13-19(35-2)16-20(14-17)36-3)25(38-27)22-7-8-30-26(32-22)31-18-5-6-23(21(28)15-18)34-9-11-37-12-10-34/h5-8,13-16H,4,9-12H2,1-3H3,(H,29,33)(H,30,31,32) |
| InChIKey | DUQVOIMXIDWSJU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|