About 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine
2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine (PubChem CID 25218025) has the molecular formula C14H15ClFN5
and a molecular weight of 307.76 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine |
| PubChem CID | 25218025 |
| Molecular Formula | C14H15ClFN5 |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine |
| SMILES | CN1CCN(c2ncnc(-c3ccc(F)cc3Cl)n2)CC1 |
| InChI | InChI=1S/C14H15ClFN5/c1-20-4-6-21(7-5-20)14-18-9-17-13(19-14)11-3-2-10(16)8-12(11)15/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | VSSGFUBLIDLKEJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine?
The IUPAC name of 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine (CID 25218025) is 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine.
What is the SMILES notation for 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine?
The canonical SMILES for 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine is CN1CCN(c2ncnc(-c3ccc(F)cc3Cl)n2)CC1.
What is the InChIKey of 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine?
The InChIKey is VSSGFUBLIDLKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClFN5/c1-20-4-6-21(7-5-20)14-18-9-17-13(19-14)11-3-2-10(16)8-12(11)15/h2-3,8-9H,4-7H2,1H3.
What are the key properties of 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine?
2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine has a molecular weight of 307.76 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4-fluorophenyl)-4-(4-methylpiperazin-1-yl)-1,3,5-triazine is sourced from PubChem (CID 25218025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).