C16H17Cl2N3 — CID 25218276
1-[2-(2,3-dichlorophenyl)-4-pyridinyl]-4-methylpiperazine (PubChem CID 25218276) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-[2-(2,3-dichlorophenyl)-4-pyridinyl]-4-methylpiperazine.
| Compound Name | 1-[2-(2,3-dichlorophenyl)-4-pyridinyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 25218276 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-[2-(2,3-dichlorophenyl)-4-pyridinyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2ccnc(-c3cccc(Cl)c3Cl)c2)CC1 |
| InChI | InChI=1S/C16H17Cl2N3/c1-20-7-9-21(10-8-20)12-5-6-19-15(11-12)13-3-2-4-14(17)16(13)18/h2-6,11H,7-10H2,1H3 |
| InChIKey | LOHMAINTPCDQKV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |