C24H28N4O2 — CID 25218323
tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl]carbamate (PubChem CID 25218323) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 25218323 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | tert-butyl N-[[1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2nccc(-c3ccc4ccccc4c3)n2)C1 |
| InChI | InChI=1S/C24H28N4O2/c1-24(2,3)30-23(29)26-15-17-11-13-28(16-17)22-25-12-10-21(27-22)20-9-8-18-6-4-5-7-19(18)14-20/h4-10,12,14,17H,11,13,15-16H2,1-3H3,(H,26,29) |
| InChIKey | FCSAHQYRZURFBC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |