C20H20N4 — CID 25218332
4-N-(4-propan-2-ylphenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine (PubChem CID 25218332) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-N-(4-propan-2-ylphenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-propan-2-ylphenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 25218332 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-N-(4-propan-2-ylphenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine |
| SMILES | CC(C)c1ccc(Nc2nc(N)nc3c2-c2ccccc2C3)cc1 |
| InChI | InChI=1S/C20H20N4/c1-12(2)13-7-9-15(10-8-13)22-19-18-16-6-4-3-5-14(16)11-17(18)23-20(21)24-19/h3-10,12H,11H2,1-2H3,(H3,21,22,23,24) |
| InChIKey | PUPIDEKMUKQDBG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |