About 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine
4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine (PubChem CID 25218336) has the molecular formula C17H13FN4
and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine |
| PubChem CID | 25218336 |
| Molecular Formula | C17H13FN4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc2c(c(Nc3ccc(F)cc3)n1)-c1ccccc1C2 |
| InChI | InChI=1S/C17H13FN4/c18-11-5-7-12(8-6-11)20-16-15-13-4-2-1-3-10(13)9-14(15)21-17(19)22-16/h1-8H,9H2,(H3,19,20,21,22) |
| InChIKey | SRFCANVGZHMDGN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine?
The IUPAC name of 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine (CID 25218336) is 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine?
The canonical SMILES for 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine is Nc1nc2c(c(Nc3ccc(F)cc3)n1)-c1ccccc1C2.
What is the InChIKey of 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine?
The InChIKey is SRFCANVGZHMDGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4/c18-11-5-7-12(8-6-11)20-16-15-13-4-2-1-3-10(13)9-14(15)21-17(19)22-16/h1-8H,9H2,(H3,19,20,21,22).
What are the key properties of 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine?
4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine has a molecular weight of 292.32 g/mol, XLogP of 3.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-fluorophenyl)-9H-indeno[2,1-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 25218336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).