C22H16Cl3F6N3O3 — CID 25218351
N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide (PubChem CID 25218351) has the molecular formula C22H16Cl3F6N3O3 and a molecular weight of 590.74 g/mol. Its IUPAC name is N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide.
| Compound Name | N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 25218351 |
| Molecular Formula | C22H16Cl3F6N3O3 |
| Molecular Weight | 590.74 g/mol |
| Exact Mass | 589.02 |
| IUPAC Name | N-[1-oxo-1-(2,2,2-trifluoroethylamino)propan-2-yl]-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
| SMILES | CC(NC(=O)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C22H16Cl3F6N3O3/c1-10(18(35)32-9-21(26,27)28)33-19(36)12-4-2-11(3-5-12)16-8-20(37-34-16,22(29,30)31)13-6-14(23)17(25)15(24)7-13/h2-7,10H,8-9H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | BIRFOYMFHHDTOS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|