About 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile
5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile (PubChem CID 25218425) has the molecular formula C17H12N4O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile |
| PubChem CID | 25218425 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile |
| SMILES | COCc1[nH]nc2cccc(Oc3cc(C#N)cc(C#N)c3)c12 |
| InChI | InChI=1S/C17H12N4O2/c1-22-10-15-17-14(20-21-15)3-2-4-16(17)23-13-6-11(8-18)5-12(7-13)9-19/h2-7H,10H2,1H3,(H,20,21) |
| InChIKey | BNHHWVFPRYHZTA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile?
The IUPAC name of 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile (CID 25218425) is 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile?
The canonical SMILES for 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile is COCc1[nH]nc2cccc(Oc3cc(C#N)cc(C#N)c3)c12.
What is the InChIKey of 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile?
The InChIKey is BNHHWVFPRYHZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2/c1-22-10-15-17-14(20-21-15)3-2-4-16(17)23-13-6-11(8-18)5-12(7-13)9-19/h2-7H,10H2,1H3,(H,20,21).
What are the key properties of 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile?
5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile has a molecular weight of 304.31 g/mol, XLogP of 3.24, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-(methoxymethyl)-2H-indazol-4-yl]oxy]benzene-1,3-dicarbonitrile is sourced from PubChem (CID 25218425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).