About 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile
5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile (PubChem CID 25218426) has the molecular formula C16H9ClN4O
and a molecular weight of 308.73 g/mol. Its IUPAC name is 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile |
| PubChem CID | 25218426 |
| Molecular Formula | C16H9ClN4O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile |
| SMILES | Cc1[nH]nc2ccc(Cl)c(Oc3cc(C#N)cc(C#N)c3)c12 |
| InChI | InChI=1S/C16H9ClN4O/c1-9-15-14(21-20-9)3-2-13(17)16(15)22-12-5-10(7-18)4-11(6-12)8-19/h2-6H,1H3,(H,20,21) |
| InChIKey | VXGYYFMKSYJDOH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile?
The IUPAC name of 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile (CID 25218426) is 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile?
The canonical SMILES for 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile is Cc1[nH]nc2ccc(Cl)c(Oc3cc(C#N)cc(C#N)c3)c12.
What is the InChIKey of 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile?
The InChIKey is VXGYYFMKSYJDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClN4O/c1-9-15-14(21-20-9)3-2-13(17)16(15)22-12-5-10(7-18)4-11(6-12)8-19/h2-6H,1H3,(H,20,21).
What are the key properties of 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile?
5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile has a molecular weight of 308.73 g/mol, XLogP of 4.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-chloro-3-methyl-2H-indazol-4-yl)oxy]benzene-1,3-dicarbonitrile is sourced from PubChem (CID 25218426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).