C25H28FN3O4 — CID 25218487
2-[[3-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]methoxy]benzamide (PubChem CID 25218487) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[[3-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]methoxy]benzamide.
| Compound Name | 2-[[3-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 25218487 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-[[3-[4-(cyclopentanecarbonyl)piperazine-1-carbonyl]-4-fluorophenyl]methoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCc1ccc(F)c(C(=O)N2CCN(C(=O)C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C25H28FN3O4/c26-21-10-9-17(16-33-22-8-4-3-7-19(22)23(27)30)15-20(21)25(32)29-13-11-28(12-14-29)24(31)18-5-1-2-6-18/h3-4,7-10,15,18H,1-2,5-6,11-14,16H2,(H2,27,30) |
| InChIKey | FCXVNULBKZOQHX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |