C26H30N4OS — CID 25218556
N-(2-amino-5-thiophen-3-ylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide (PubChem CID 25218556) has the molecular formula C26H30N4OS and a molecular weight of 446.62 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-3-ylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide.
| Compound Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide |
|---|---|
| PubChem CID | 25218556 |
| Molecular Formula | C26H30N4OS |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-(1,8-diazaspiro[4.5]decan-8-ylmethyl)benzamide |
| SMILES | Nc1ccc(-c2ccsc2)cc1NC(=O)c1ccc(CN2CCC3(CCCN3)CC2)cc1 |
| InChI | InChI=1S/C26H30N4OS/c27-23-7-6-21(22-8-15-32-18-22)16-24(23)29-25(31)20-4-2-19(3-5-20)17-30-13-10-26(11-14-30)9-1-12-28-26/h2-8,15-16,18,28H,1,9-14,17,27H2,(H,29,31) |
| InChIKey | VEXQHQFUNPNAIM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|