C27H31FN8O2 — CID 25218564
2-fluoro-6-[[2-[2-methoxy-5-(4-propan-2-ylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]benzamide (PubChem CID 25218564) has the molecular formula C27H31FN8O2 and a molecular weight of 518.60 g/mol. Its IUPAC name is 2-fluoro-6-[[2-[2-methoxy-5-(4-propan-2-ylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]benzamide.
| Compound Name | 2-fluoro-6-[[2-[2-methoxy-5-(4-propan-2-ylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 25218564 |
| Molecular Formula | C27H31FN8O2 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | 2-fluoro-6-[[2-[2-methoxy-5-(4-propan-2-ylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]benzamide |
| SMILES | COc1ccc(N2CCN(C(C)C)CC2)cc1Nc1nc(Nc2cccc(F)c2C(N)=O)c2cc[nH]c2n1 |
| InChI | InChI=1S/C27H31FN8O2/c1-16(2)35-11-13-36(14-12-35)17-7-8-22(38-3)21(15-17)32-27-33-25-18(9-10-30-25)26(34-27)31-20-6-4-5-19(28)23(20)24(29)37/h4-10,15-16H,11-14H2,1-3H3,(H2,29,37)(H3,30,31,32,33,34) |
| InChIKey | FIJVJJGBQDYFNS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|