C25H28FN7O3 — CID 25218566
2-[[2-[5-[3-(dimethylamino)propoxy]-2-methoxyanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-6-fluorobenzamide (PubChem CID 25218566) has the molecular formula C25H28FN7O3 and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[[2-[5-[3-(dimethylamino)propoxy]-2-methoxyanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-6-fluorobenzamide.
| Compound Name | 2-[[2-[5-[3-(dimethylamino)propoxy]-2-methoxyanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-6-fluorobenzamide |
|---|---|
| PubChem CID | 25218566 |
| Molecular Formula | C25H28FN7O3 |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 2-[[2-[5-[3-(dimethylamino)propoxy]-2-methoxyanilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]-6-fluorobenzamide |
| SMILES | COc1ccc(OCCCN(C)C)cc1Nc1nc(Nc2cccc(F)c2C(N)=O)c2cc[nH]c2n1 |
| InChI | InChI=1S/C25H28FN7O3/c1-33(2)12-5-13-36-15-8-9-20(35-3)19(14-15)30-25-31-23-16(10-11-28-23)24(32-25)29-18-7-4-6-17(26)21(18)22(27)34/h4,6-11,14H,5,12-13H2,1-3H3,(H2,27,34)(H3,28,29,30,31,32) |
| InChIKey | LQRGRVAYEDLPTG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|