C27H34N6O3 — CID 25218663
8-cyclohexyl-N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 25218663) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 8-cyclohexyl-N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 8-cyclohexyl-N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 25218663 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 8-cyclohexyl-N-methoxy-2-[4-(1-methylpiperidin-4-yl)anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1cn(C2CCCCC2)c2nc(Nc3ccc(C4CCN(C)CC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C27H34N6O3/c1-32-14-12-19(13-15-32)18-8-10-20(11-9-18)29-27-28-16-22-24(34)23(26(35)31-36-2)17-33(25(22)30-27)21-6-4-3-5-7-21/h8-11,16-17,19,21H,3-7,12-15H2,1-2H3,(H,31,35)(H,28,29,30) |
| InChIKey | HMRDXCZNJVAJQN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|