C30H32N4O5 — CID 25218703
2-[(2-methylphenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 25218703) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[(2-methylphenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25218703 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 2-[(2-methylphenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1cc(-c2nc(NCc3ccccc3C)ncc2C(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H32N4O5/c1-20-10-8-9-11-21(20)18-32-30-33-19-24(29(35)31-14-15-39-23-12-6-5-7-13-23)27(34-30)22-16-25(36-2)28(38-4)26(17-22)37-3/h5-13,16-17,19H,14-15,18H2,1-4H3,(H,31,35)(H,32,33,34) |
| InChIKey | ZBOZUWKYQJFQMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|