C31H34N4O6 — CID 25218712
2-[2-(3-methoxyphenyl)ethylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 25218712) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-[2-(3-methoxyphenyl)ethylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(3-methoxyphenyl)ethylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25218712 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-[2-(3-methoxyphenyl)ethylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1cccc(CCNc2ncc(C(=O)NCCOc3ccccc3)c(-c3cc(OC)c(OC)c(OC)c3)n2)c1 |
| InChI | InChI=1S/C31H34N4O6/c1-37-24-12-8-9-21(17-24)13-14-33-31-34-20-25(30(36)32-15-16-41-23-10-6-5-7-11-23)28(35-31)22-18-26(38-2)29(40-4)27(19-22)39-3/h5-12,17-20H,13-16H2,1-4H3,(H,32,36)(H,33,34,35) |
| InChIKey | NENQXGONNRBALC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|