C28H27N5O6 — CID 25218729
2-(1,3-benzodioxol-5-ylmethylamino)-4-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyrimidine-5-carboxamide (PubChem CID 25218729) has the molecular formula C28H27N5O6 and a molecular weight of 529.55 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-4-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-4-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25218729 |
| Molecular Formula | C28H27N5O6 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-4-(2,6-dimethoxy-3-pyridinyl)-N-(2-phenoxyethyl)pyrimidine-5-carboxamide |
| SMILES | COc1ccc(-c2nc(NCc3ccc4c(c3)OCO4)ncc2C(=O)NCCOc2ccccc2)c(OC)n1 |
| InChI | InChI=1S/C28H27N5O6/c1-35-24-11-9-20(27(32-24)36-2)25-21(26(34)29-12-13-37-19-6-4-3-5-7-19)16-31-28(33-25)30-15-18-8-10-22-23(14-18)39-17-38-22/h3-11,14,16H,12-13,15,17H2,1-2H3,(H,29,34)(H,30,31,33) |
| InChIKey | ACUIVHWRXISZPQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|