C31H31N3O7 — CID 25218734
6-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide (PubChem CID 25218734) has the molecular formula C31H31N3O7 and a molecular weight of 557.60 g/mol. Its IUPAC name is 6-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25218734 |
| Molecular Formula | C31H31N3O7 |
| Molecular Weight | 557.60 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 6-(1,3-benzodioxol-5-ylmethylamino)-N-(2-phenoxyethyl)-2-(3,4,5-trimethoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cc(-c2nc(NCc3ccc4c(c3)OCO4)ccc2C(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C31H31N3O7/c1-36-26-16-21(17-27(37-2)30(26)38-3)29-23(31(35)32-13-14-39-22-7-5-4-6-8-22)10-12-28(34-29)33-18-20-9-11-24-25(15-20)41-19-40-24/h4-12,15-17H,13-14,18-19H2,1-3H3,(H,32,35)(H,33,34) |
| InChIKey | HSVSYUQSHIQVSF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|