C11H14ClNO — CID 25218955
2-chloro-N-(2,5-dimethylphenyl)propanamide (PubChem CID 25218955) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 2-chloro-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | 2-chloro-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 25218955 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-chloro-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)C(C)Cl)c1 |
| InChI | InChI=1S/C11H14ClNO/c1-7-4-5-8(2)10(6-7)13-11(14)9(3)12/h4-6,9H,1-3H3,(H,13,14) |
| InChIKey | XFJQOYYSGXWMEA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|