About [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine
[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 25219208) has the molecular formula C5H9N3O2
and a molecular weight of 143.15 g/mol. Its IUPAC name is [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine |
| PubChem CID | 25219208 |
| Molecular Formula | C5H9N3O2 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | COCc1noc(CN)n1 |
| InChI | InChI=1S/C5H9N3O2/c1-9-3-4-7-5(2-6)10-8-4/h2-3,6H2,1H3 |
| InChIKey | GVMRQEDXKZKKPX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The IUPAC name of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine (CID 25219208) is [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine.
What is the SMILES notation for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The canonical SMILES for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine is COCc1noc(CN)n1.
What is the InChIKey of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine?
The InChIKey is GVMRQEDXKZKKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O2/c1-9-3-4-7-5(2-6)10-8-4/h2-3,6H2,1H3.
What are the key properties of [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine?
[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine has a molecular weight of 143.15 g/mol, XLogP of -0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]methanamine is sourced from PubChem (CID 25219208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).