About 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine
2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine (PubChem CID 25219407) has the molecular formula C9H12N4O
and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine.
Molecular Properties
| Compound Name | 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine |
| PubChem CID | 25219407 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(CN=[N+]=[N-])c1C |
| InChI | InChI=1S/C9H12N4O/c1-6-4-11-8(5-12-13-10)7(2)9(6)14-3/h4H,5H2,1-3H3 |
| InChIKey | DOIVWEUSKRITNF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine?
The IUPAC name of 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine (CID 25219407) is 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine.
What is the SMILES notation for 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine?
The canonical SMILES for 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine is COc1c(C)cnc(CN=[N+]=[N-])c1C.
What is the InChIKey of 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine?
The InChIKey is DOIVWEUSKRITNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O/c1-6-4-11-8(5-12-13-10)7(2)9(6)14-3/h4H,5H2,1-3H3.
What are the key properties of 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine?
2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine has a molecular weight of 192.22 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-4-methoxy-3,5-dimethylpyridine is sourced from PubChem (CID 25219407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).