C10H10ClNO4S — CID 25219434
4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride (PubChem CID 25219434) has the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. Its IUPAC name is 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride.
| Compound Name | 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride |
|---|---|
| PubChem CID | 25219434 |
| Molecular Formula | C10H10ClNO4S |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride |
| SMILES | CC(=O)N1CCOc2ccc(S(=O)(=O)Cl)cc21 |
| InChI | InChI=1S/C10H10ClNO4S/c1-7(13)12-4-5-16-10-3-2-8(6-9(10)12)17(11,14)15/h2-3,6H,4-5H2,1H3 |
| InChIKey | ABMZXQIJEDEIAB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |