4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride

C10H10ClNO4S — CID 25219434

IUPAC4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride
SMILESCC(=O)N1CCOc2ccc(S(=O)(=O)Cl)cc21
InChIInChI=1S/C10H10ClNO4S/c1-7(13)12-4-5-16-10-3-2-8(6-9(10)12)17(11,14)15/h2-3,6H,4-5H2,1H3
InChIKeyABMZXQIJEDEIAB-UHFFFAOYSA-N
MW275.71 g/mol
LogP1.36
Rot. Bonds1

About 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride

4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride (PubChem CID 25219434) has the molecular formula C10H10ClNO4S and a molecular weight of 275.71 g/mol. Its IUPAC name is 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride.

Molecular Properties

Compound Name4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride
PubChem CID25219434
Molecular FormulaC10H10ClNO4S
Molecular Weight275.71 g/mol
Exact Mass275.00
IUPAC Name4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride
SMILESCC(=O)N1CCOc2ccc(S(=O)(=O)Cl)cc21
InChIInChI=1S/C10H10ClNO4S/c1-7(13)12-4-5-16-10-3-2-8(6-9(10)12)17(11,14)15/h2-3,6H,4-5H2,1H3
InChIKeyABMZXQIJEDEIAB-UHFFFAOYSA-N
XLogP1.36
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.71
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride?
The IUPAC name of 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride (CID 25219434) is 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride.
What is the SMILES notation for 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride?
The canonical SMILES for 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride is CC(=O)N1CCOc2ccc(S(=O)(=O)Cl)cc21.
What is the InChIKey of 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride?
The InChIKey is ABMZXQIJEDEIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClNO4S/c1-7(13)12-4-5-16-10-3-2-8(6-9(10)12)17(11,14)15/h2-3,6H,4-5H2,1H3.
What are the key properties of 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride?
4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride has a molecular weight of 275.71 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-2,3-dihydro-1,4-benzoxazine-6-sulfonyl chloride is sourced from PubChem (CID 25219434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).