About 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine
3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine (PubChem CID 25219665) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine |
| PubChem CID | 25219665 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine |
| SMILES | Cc1n[nH]c(C)c1CCCN |
| InChI | InChI=1S/C8H15N3/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3,(H,10,11) |
| InChIKey | LCGYDKLNJOBMBD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine (CID 25219665) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine is Cc1n[nH]c(C)c1CCCN.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine?
The InChIKey is LCGYDKLNJOBMBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-6-8(4-3-5-9)7(2)11-10-6/h3-5,9H2,1-2H3,(H,10,11).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine?
3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine has a molecular weight of 153.23 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propan-1-amine is sourced from PubChem (CID 25219665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).