About 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione
3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione (PubChem CID 25220147) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione |
| PubChem CID | 25220147 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione |
| SMILES | COc1ccccc1N1C=CC(C)(C)NC1=S |
| InChI | InChI=1S/C13H16N2OS/c1-13(2)8-9-15(12(17)14-13)10-6-4-5-7-11(10)16-3/h4-9H,1-3H3,(H,14,17) |
| InChIKey | PXNMNFBONJYQDJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione?
The IUPAC name of 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione (CID 25220147) is 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione?
The canonical SMILES for 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione is COc1ccccc1N1C=CC(C)(C)NC1=S.
What is the InChIKey of 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione?
The InChIKey is PXNMNFBONJYQDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-13(2)8-9-15(12(17)14-13)10-6-4-5-7-11(10)16-3/h4-9H,1-3H3,(H,14,17).
What are the key properties of 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione?
3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione has a molecular weight of 248.35 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)-6,6-dimethyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 25220147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).