C12H9ClN2O4S2 — CID 25220301
2-chloro-5-[[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetyl]amino]benzoic acid (PubChem CID 25220301) has the molecular formula C12H9ClN2O4S2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-chloro-5-[[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetyl]amino]benzoic acid.
| Compound Name | 2-chloro-5-[[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 25220301 |
| Molecular Formula | C12H9ClN2O4S2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-chloro-5-[[2-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)acetyl]amino]benzoic acid |
| SMILES | O=C(CC1SC(=S)NC1=O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H9ClN2O4S2/c13-7-2-1-5(3-6(7)11(18)19)14-9(16)4-8-10(17)15-12(20)21-8/h1-3,8H,4H2,(H,14,16)(H,18,19)(H,15,17,20) |
| InChIKey | DTZXVLKDWMJBJS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|