About 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid (PubChem CID 25220384) has the molecular formula C5H6N4O2S
and a molecular weight of 186.20 g/mol. Its IUPAC name is 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid |
| PubChem CID | 25220384 |
| Molecular Formula | C5H6N4O2S |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid |
| SMILES | Nc1ncnc(SCC(=O)O)n1 |
| InChI | InChI=1S/C5H6N4O2S/c6-4-7-2-8-5(9-4)12-1-3(10)11/h2H,1H2,(H,10,11)(H2,6,7,8,9) |
| InChIKey | FUMGCWBUHRJMSP-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid (CID 25220384) is 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid is Nc1ncnc(SCC(=O)O)n1.
What is the InChIKey of 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
The InChIKey is FUMGCWBUHRJMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2S/c6-4-7-2-8-5(9-4)12-1-3(10)11/h2H,1H2,(H,10,11)(H2,6,7,8,9).
What are the key properties of 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid?
2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid has a molecular weight of 186.20 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,3,5-triazin-2-yl)sulfanyl]acetic acid is sourced from PubChem (CID 25220384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).