3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid

C6H9NO3 — CID 25220791

IUPAC3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1=NOC(C)(C(=O)O)C1
InChIInChI=1S/C6H9NO3/c1-4-3-6(2,5(8)9)10-7-4/h3H2,1-2H3,(H,8,9)
InChIKeySKHXMZPMVWJQQE-UHFFFAOYSA-N
MW143.14 g/mol
LogP0.63
Rot. Bonds1

About 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid

3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 25220791) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid
PubChem CID25220791
Molecular FormulaC6H9NO3
Molecular Weight143.14 g/mol
Exact Mass143.06
IUPAC Name3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid
SMILESCC1=NOC(C)(C(=O)O)C1
InChIInChI=1S/C6H9NO3/c1-4-3-6(2,5(8)9)10-7-4/h3H2,1-2H3,(H,8,9)
InChIKeySKHXMZPMVWJQQE-UHFFFAOYSA-N
XLogP0.63
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.14
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid (CID 25220791) is 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid is CC1=NOC(C)(C(=O)O)C1.
What is the InChIKey of 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is SKHXMZPMVWJQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-4-3-6(2,5(8)9)10-7-4/h3H2,1-2H3,(H,8,9).
What are the key properties of 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid?
3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 143.14 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 25220791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).