About [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine
[5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine (PubChem CID 25220799) has the molecular formula C10H9ClN2O
and a molecular weight of 208.65 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine |
| PubChem CID | 25220799 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine |
| SMILES | NCc1cc(-c2ccccc2Cl)on1 |
| InChI | InChI=1S/C10H9ClN2O/c11-9-4-2-1-3-8(9)10-5-7(6-12)13-14-10/h1-5H,6,12H2 |
| InChIKey | MOQQYZHQEGCEFM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine?
The IUPAC name of [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine (CID 25220799) is [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine.
What is the SMILES notation for [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine?
The canonical SMILES for [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine is NCc1cc(-c2ccccc2Cl)on1.
What is the InChIKey of [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine?
The InChIKey is MOQQYZHQEGCEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN2O/c11-9-4-2-1-3-8(9)10-5-7(6-12)13-14-10/h1-5H,6,12H2.
What are the key properties of [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine?
[5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine has a molecular weight of 208.65 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanamine is sourced from PubChem (CID 25220799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).