C9H12N2O2 — CID 25220832
spiro[1,3-dioxolane-2,5'-1,4,6,7-tetrahydroindazole] (PubChem CID 25220832) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,5'-1,4,6,7-tetrahydroindazole].
| Compound Name | spiro[1,3-dioxolane-2,5'-1,4,6,7-tetrahydroindazole] |
|---|---|
| PubChem CID | 25220832 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | spiro[1,3-dioxolane-2,5'-1,4,6,7-tetrahydroindazole] |
| SMILES | c1n[nH]c2c1CC1(CC2)OCCO1 |
| InChI | InChI=1S/C9H12N2O2/c1-2-9(12-3-4-13-9)5-7-6-10-11-8(1)7/h6H,1-5H2,(H,10,11) |
| InChIKey | OYRFOTULFRTQGH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |