C11H20N2O2 — CID 25220884
(3S,6S)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 25220884) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3S,6S)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 25220884 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3S,6S)-3-(2-methylpropyl)-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C11H20N2O2/c1-6(2)5-8-10(14)13-9(7(3)4)11(15)12-8/h6-9H,5H2,1-4H3,(H,12,15)(H,13,14)/t8-,9-/m0/s1 |
| InChIKey | UPOUGDHEEGKEGS-IUCAKERBSA-N |
| XLogP | 0.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |