C23H23ClFN5OS — CID 25221099
(E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-en-1-one (PubChem CID 25221099) has the molecular formula C23H23ClFN5OS and a molecular weight of 471.99 g/mol. Its IUPAC name is (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 25221099 |
| Molecular Formula | C23H23ClFN5OS |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (E)-1-[3-(3-chloro-4-fluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-3-[(2S)-1-methylpyrrolidin-2-yl]prop-2-en-1-one |
| SMILES | CN1CCC[C@H]1/C=C/C(=O)N1CCc2c(sc3ncnc(Nc4ccc(F)c(Cl)c4)c23)C1 |
| InChI | InChI=1S/C23H23ClFN5OS/c1-29-9-2-3-15(29)5-7-20(31)30-10-8-16-19(12-30)32-23-21(16)22(26-13-27-23)28-14-4-6-18(25)17(24)11-14/h4-7,11,13,15H,2-3,8-10,12H2,1H3,(H,26,27,28)/b7-5+/t15-/m0/s1 |
| InChIKey | IHAMQXNCAXXWHB-ZKKXHLJNSA-N |
| XLogP | 4.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|