C31H38ClN3O — CID 25221265
1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-4-[(4-propan-2-ylphenyl)methylamino]butan-1-one (PubChem CID 25221265) has the molecular formula C31H38ClN3O and a molecular weight of 504.12 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-4-[(4-propan-2-ylphenyl)methylamino]butan-1-one.
| Compound Name | 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-4-[(4-propan-2-ylphenyl)methylamino]butan-1-one |
|---|---|
| PubChem CID | 25221265 |
| Molecular Formula | C31H38ClN3O |
| Molecular Weight | 504.12 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-4-[(4-propan-2-ylphenyl)methylamino]butan-1-one |
| SMILES | CC(C)c1ccc(CNCCCC(=O)N2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H38ClN3O/c1-24(2)26-12-10-25(11-13-26)23-33-18-6-9-30(36)34-19-21-35(22-20-34)31(27-7-4-3-5-8-27)28-14-16-29(32)17-15-28/h3-5,7-8,10-17,24,31,33H,6,9,18-23H2,1-2H3 |
| InChIKey | SCFCZEJBFLOUQO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.12 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|