C28H31FN4O6 — CID 25221280
5-fluoro-10-(3-hydroxyphenyl)-4-(2-methoxyethoxy)-13-(2-morpholin-4-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 25221280) has the molecular formula C28H31FN4O6 and a molecular weight of 538.58 g/mol. Its IUPAC name is 5-fluoro-10-(3-hydroxyphenyl)-4-(2-methoxyethoxy)-13-(2-morpholin-4-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | 5-fluoro-10-(3-hydroxyphenyl)-4-(2-methoxyethoxy)-13-(2-morpholin-4-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 25221280 |
| Molecular Formula | C28H31FN4O6 |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 5-fluoro-10-(3-hydroxyphenyl)-4-(2-methoxyethoxy)-13-(2-morpholin-4-ylethyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | COCCOc1cc2c3c([nH]c2cc1F)C(c1cccc(O)c1)N1C(=O)N(CCN2CCOCC2)C(=O)C1C3 |
| InChI | InChI=1S/C28H31FN4O6/c1-37-11-12-39-24-15-19-20-14-23-27(35)32(6-5-31-7-9-38-10-8-31)28(36)33(23)26(17-3-2-4-18(34)13-17)25(20)30-22(19)16-21(24)29/h2-4,13,15-16,23,26,30,34H,5-12,14H2,1H3 |
| InChIKey | FAMWHGMTPBOGGA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|