C22H23N3O5 — CID 25221322
dimethyl (2S,6R)-4-oxo-1-prop-2-enyl-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate (PubChem CID 25221322) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is dimethyl (2S,6R)-4-oxo-1-prop-2-enyl-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate.
| Compound Name | dimethyl (2S,6R)-4-oxo-1-prop-2-enyl-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 25221322 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | dimethyl (2S,6R)-4-oxo-1-prop-2-enyl-2,6-dipyridin-2-ylpiperidine-3,5-dicarboxylate |
| SMILES | C=CCN1[C@H](c2ccccn2)C(C(=O)OC)C(=O)C(C(=O)OC)[C@@H]1c1ccccn1 |
| InChI | InChI=1S/C22H23N3O5/c1-4-13-25-18(14-9-5-7-11-23-14)16(21(27)29-2)20(26)17(22(28)30-3)19(25)15-10-6-8-12-24-15/h4-12,16-19H,1,13H2,2-3H3/t16?,17?,18-,19+ |
| InChIKey | VNRGZGMBZXQNDQ-YHFFBGSDSA-N |
| XLogP | 1.91 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|