C17H14F6N2O3S — CID 25221473
4-methyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide (PubChem CID 25221473) has the molecular formula C17H14F6N2O3S and a molecular weight of 440.37 g/mol. Its IUPAC name is 4-methyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-methyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25221473 |
| Molecular Formula | C17H14F6N2O3S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 4-methyl-5-[(2,3,6-trifluorophenyl)-(3,3,3-trifluoropropylsulfonyl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(N)=O)ncc1C(c1c(F)ccc(F)c1F)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C17H14F6N2O3S/c1-8-6-12(16(24)26)25-7-9(8)15(29(27,28)5-4-17(21,22)23)13-10(18)2-3-11(19)14(13)20/h2-3,6-7,15H,4-5H2,1H3,(H2,24,26) |
| InChIKey | HFFPJUZWAQNVLL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|