C18H16F6N2O3S — CID 25221477
4-methyl-5-[4,4,4-trifluorobutylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide (PubChem CID 25221477) has the molecular formula C18H16F6N2O3S and a molecular weight of 454.39 g/mol. Its IUPAC name is 4-methyl-5-[4,4,4-trifluorobutylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-methyl-5-[4,4,4-trifluorobutylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25221477 |
| Molecular Formula | C18H16F6N2O3S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 4-methyl-5-[4,4,4-trifluorobutylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(N)=O)ncc1C(c1c(F)ccc(F)c1F)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C18H16F6N2O3S/c1-9-7-13(17(25)27)26-8-10(9)16(14-11(19)3-4-12(20)15(14)21)30(28,29)6-2-5-18(22,23)24/h3-4,7-8,16H,2,5-6H2,1H3,(H2,25,27) |
| InChIKey | KPAWVYAWUJZZSV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|