C22H39NO — CID 25221579
(2E,4E,12Z)-N-(2-methylpropyl)octadeca-2,4,12-trienamide (PubChem CID 25221579) has the molecular formula C22H39NO and a molecular weight of 333.56 g/mol. Its IUPAC name is (2E,4E,12Z)-N-(2-methylpropyl)octadeca-2,4,12-trienamide.
| Compound Name | (2E,4E,12Z)-N-(2-methylpropyl)octadeca-2,4,12-trienamide |
|---|---|
| PubChem CID | 25221579 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | (2E,4E,12Z)-N-(2-methylpropyl)octadeca-2,4,12-trienamide |
| SMILES | CCCCC/C=C\CCCCCC/C=C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C22H39NO/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(24)23-20-21(2)3/h8-9,16-19,21H,4-7,10-15,20H2,1-3H3,(H,23,24)/b9-8-,17-16+,19-18+ |
| InChIKey | PCWWIOUZYOPZHT-VBUSEHTESA-N |
| XLogP | 6.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|