C18H17F5N2OS — CID 25221597
5-[3,3-difluorobutylsulfanyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide (PubChem CID 25221597) has the molecular formula C18H17F5N2OS and a molecular weight of 404.40 g/mol. Its IUPAC name is 5-[3,3-difluorobutylsulfanyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide.
| Compound Name | 5-[3,3-difluorobutylsulfanyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 25221597 |
| Molecular Formula | C18H17F5N2OS |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 5-[3,3-difluorobutylsulfanyl-(2,3,6-trifluorophenyl)methyl]-4-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C(N)=O)ncc1C(SCCC(C)(F)F)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C18H17F5N2OS/c1-9-7-13(17(24)26)25-8-10(9)16(27-6-5-18(2,22)23)14-11(19)3-4-12(20)15(14)21/h3-4,7-8,16H,5-6H2,1-2H3,(H2,24,26) |
| InChIKey | VLCAJGKJBYSVHM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|