C17H17F3N2O3S — CID 25221704
4-methyl-5-[propylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide (PubChem CID 25221704) has the molecular formula C17H17F3N2O3S and a molecular weight of 386.40 g/mol. Its IUPAC name is 4-methyl-5-[propylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-methyl-5-[propylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25221704 |
| Molecular Formula | C17H17F3N2O3S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 4-methyl-5-[propylsulfonyl-(2,3,6-trifluorophenyl)methyl]pyridine-2-carboxamide |
| SMILES | CCCS(=O)(=O)C(c1cnc(C(N)=O)cc1C)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C17H17F3N2O3S/c1-3-6-26(24,25)16(14-11(18)4-5-12(19)15(14)20)10-8-22-13(17(21)23)7-9(10)2/h4-5,7-8,16H,3,6H2,1-2H3,(H2,21,23) |
| InChIKey | AIXAWLLUMIWWKF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|