About 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol
2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol (PubChem CID 25222679) has the molecular formula C26H40N2O2S
and a molecular weight of 444.69 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol |
| PubChem CID | 25222679 |
| Molecular Formula | C26H40N2O2S |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol |
| SMILES | CCN(CC)C1(c2nc(-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cs2)CCOCC1 |
| InChI | InChI=1S/C26H40N2O2S/c1-9-28(10-2)26(11-13-30-14-12-26)23-27-21(17-31-23)18-15-19(24(3,4)5)22(29)20(16-18)25(6,7)8/h15-17,29H,9-14H2,1-8H3 |
| InChIKey | GXWDJBMYGJCJFQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol?
The IUPAC name of 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol (CID 25222679) is 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol.
What is the SMILES notation for 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol?
The canonical SMILES for 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol is CCN(CC)C1(c2nc(-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cs2)CCOCC1.
What is the InChIKey of 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol?
The InChIKey is GXWDJBMYGJCJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H40N2O2S/c1-9-28(10-2)26(11-13-30-14-12-26)23-27-21(17-31-23)18-15-19(24(3,4)5)22(29)20(16-18)25(6,7)8/h15-17,29H,9-14H2,1-8H3.
What are the key properties of 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol?
2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol has a molecular weight of 444.69 g/mol, XLogP of 6.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-4-[2-[4-(diethylamino)oxan-4-yl]-1,3-thiazol-4-yl]phenol is sourced from PubChem (CID 25222679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).