C14H21IO3Si — CID 25222925
(2S,3R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4-iodo-1-oxaspiro[2.4]hept-4-en-6-ol (PubChem CID 25222925) has the molecular formula C14H21IO3Si and a molecular weight of 392.31 g/mol. Its IUPAC name is (2S,3R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4-iodo-1-oxaspiro[2.4]hept-4-en-6-ol.
| Compound Name | (2S,3R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4-iodo-1-oxaspiro[2.4]hept-4-en-6-ol |
|---|---|
| PubChem CID | 25222925 |
| Molecular Formula | C14H21IO3Si |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | (2S,3R,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-4-iodo-1-oxaspiro[2.4]hept-4-en-6-ol |
| SMILES | C#C[C@@H]1O[C@]12C(I)=C[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H21IO3Si/c1-7-11-14(17-11)10(15)8-9(16)12(14)18-19(5,6)13(2,3)4/h1,8-9,11-12,16H,2-6H3/t9-,11+,12+,14-/m1/s1 |
| InChIKey | OAISSUCQPQZWCP-GASQSECBSA-N |
| XLogP | 2.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|