About 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine
5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine (PubChem CID 25222947) has the molecular formula C7H6BrN3
and a molecular weight of 212.05 g/mol. Its IUPAC name is 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine |
| PubChem CID | 25222947 |
| Molecular Formula | C7H6BrN3 |
| Molecular Weight | 212.05 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine |
| SMILES | Cc1[nH]nc2cnc(Br)cc12 |
| InChI | InChI=1S/C7H6BrN3/c1-4-5-2-7(8)9-3-6(5)11-10-4/h2-3H,1H3,(H,10,11) |
| InChIKey | OPJNRVAWKYSENX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.05 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine?
The IUPAC name of 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine (CID 25222947) is 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine is Cc1[nH]nc2cnc(Br)cc12.
What is the InChIKey of 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine?
The InChIKey is OPJNRVAWKYSENX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3/c1-4-5-2-7(8)9-3-6(5)11-10-4/h2-3H,1H3,(H,10,11).
What are the key properties of 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine?
5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine has a molecular weight of 212.05 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-methyl-2H-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 25222947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).