About (3S)-1,2,3,4-tetrahydroquinolin-3-ol
(3S)-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 25223044) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (3S)-1,2,3,4-tetrahydroquinolin-3-ol.
Molecular Properties
| Compound Name | (3S)-1,2,3,4-tetrahydroquinolin-3-ol |
| PubChem CID | 25223044 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (3S)-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | O[C@@H]1CNc2ccccc2C1 |
| InChI | InChI=1S/C9H11NO/c11-8-5-7-3-1-2-4-9(7)10-6-8/h1-4,8,10-11H,5-6H2/t8-/m0/s1 |
| InChIKey | BCUWDJPRIHGCRN-QMMMGPOBSA-N |
| XLogP | 1.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1,2,3,4-tetrahydroquinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,2,3,4-tetrahydroquinolin-3-ol?
The IUPAC name of (3S)-1,2,3,4-tetrahydroquinolin-3-ol (CID 25223044) is (3S)-1,2,3,4-tetrahydroquinolin-3-ol.
What is the SMILES notation for (3S)-1,2,3,4-tetrahydroquinolin-3-ol?
The canonical SMILES for (3S)-1,2,3,4-tetrahydroquinolin-3-ol is O[C@@H]1CNc2ccccc2C1.
What is the InChIKey of (3S)-1,2,3,4-tetrahydroquinolin-3-ol?
The InChIKey is BCUWDJPRIHGCRN-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H11NO/c11-8-5-7-3-1-2-4-9(7)10-6-8/h1-4,8,10-11H,5-6H2/t8-/m0/s1.
What are the key properties of (3S)-1,2,3,4-tetrahydroquinolin-3-ol?
(3S)-1,2,3,4-tetrahydroquinolin-3-ol has a molecular weight of 149.19 g/mol, XLogP of 1.02, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,2,3,4-tetrahydroquinolin-3-ol is sourced from PubChem (CID 25223044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).