About [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate
[3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate (PubChem CID 25223228) has the molecular formula C17H19ClN2O4S2
and a molecular weight of 414.94 g/mol. Its IUPAC name is [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate |
| PubChem CID | 25223228 |
| Molecular Formula | C17H19ClN2O4S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate |
| SMILES | [H]/N=C(\N)SCCCOc1cc(C)cc(OS(=O)(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-12-9-13(23-7-4-8-25-17(19)20)11-14(10-12)24-26(21,22)16-6-3-2-5-15(16)18/h2-3,5-6,9-11H,4,7-8H2,1H3,(H3,19,20) |
| InChIKey | NPRLPEGFOKQTLC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate?
The IUPAC name of [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate (CID 25223228) is [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate.
What is the SMILES notation for [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate?
The canonical SMILES for [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate is [H]/N=C(\N)SCCCOc1cc(C)cc(OS(=O)(=O)c2ccccc2Cl)c1.
What is the InChIKey of [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate?
The InChIKey is NPRLPEGFOKQTLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O4S2/c1-12-9-13(23-7-4-8-25-17(19)20)11-14(10-12)24-26(21,22)16-6-3-2-5-15(16)18/h2-3,5-6,9-11H,4,7-8H2,1H3,(H3,19,20).
What are the key properties of [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate?
[3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate has a molecular weight of 414.94 g/mol, XLogP of 3.81, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-carbamimidoylsulfanylpropoxy)-5-methylphenyl] 2-chlorobenzenesulfonate is sourced from PubChem (CID 25223228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).