C29H31BrN2 — CID 25223242
1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydrobenzo[e]benzimidazol-1-ium bromide (PubChem CID 25223242) has the molecular formula C29H31BrN2 and a molecular weight of 487.49 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydrobenzo[e]benzimidazol-1-ium bromide.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydrobenzo[e]benzimidazol-1-ium bromide |
|---|---|
| PubChem CID | 25223242 |
| Molecular Formula | C29H31BrN2 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-4,5-dihydrobenzo[e]benzimidazol-1-ium bromide |
| SMILES | Cc1cc(C)c(-n2c[n+](-c3c(C)cc(C)cc3C)c3c2CCc2ccccc2-3)c(C)c1.[Br-] |
| InChI | InChI=1S/C29H31N2.BrH/c1-18-13-20(3)27(21(4)14-18)30-17-31(28-22(5)15-19(2)16-23(28)6)29-25-10-8-7-9-24(25)11-12-26(29)30;/h7-10,13-17H,11-12H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | WLIFUFCNHAFJCX-UHFFFAOYSA-M |
| XLogP | 3.37 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|