C20H30O2 — CID 25223317
(1R,2R,6S,9R,10S,13S,14S)-13-hydroxy-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one (PubChem CID 25223317) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2R,6S,9R,10S,13S,14S)-13-hydroxy-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one.
| Compound Name | (1R,2R,6S,9R,10S,13S,14S)-13-hydroxy-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
|---|---|
| PubChem CID | 25223317 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2R,6S,9R,10S,13S,14S)-13-hydroxy-2,6,11,11,14-pentamethyltetracyclo[7.6.0.01,6.010,14]pentadec-3-en-5-one |
| SMILES | C[C@@H]1C=CC(=O)[C@@]2(C)CC[C@@H]3[C@H]4C(C)(C)C[C@H](O)[C@@]4(C)C[C@@]132 |
| InChI | InChI=1S/C20H30O2/c1-12-6-7-14(21)19(5)9-8-13-16-17(2,3)10-15(22)18(16,4)11-20(12,13)19/h6-7,12-13,15-16,22H,8-11H2,1-5H3/t12-,13-,15+,16+,18-,19-,20-/m1/s1 |
| InChIKey | IVILGQFEEVXKDO-QGKRQCMOSA-N |
| XLogP | 3.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |