C22H26Cl2N6O4S — CID 25223618
2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-(1,4,5-trimethylimidazol-2-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 25223618) has the molecular formula C22H26Cl2N6O4S and a molecular weight of 541.46 g/mol. Its IUPAC name is 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-(1,4,5-trimethylimidazol-2-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-(1,4,5-trimethylimidazol-2-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 25223618 |
| Molecular Formula | C22H26Cl2N6O4S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methoxypiperidin-1-yl]-4-(1,4,5-trimethylimidazol-2-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CO[C@H]1CN(c2nc(-c3nc(C)c(C)n3C)c(C(=O)O)s2)CC[C@H]1NC(=O)c1[nH]c(C)c(Cl)c1Cl |
| InChI | InChI=1S/C22H26Cl2N6O4S/c1-9-11(3)29(4)19(26-9)17-18(21(32)33)35-22(28-17)30-7-6-12(13(8-30)34-5)27-20(31)16-15(24)14(23)10(2)25-16/h12-13,25H,6-8H2,1-5H3,(H,27,31)(H,32,33)/t12-,13+/m1/s1 |
| InChIKey | KPIOIQAQJYZGQJ-OLZOCXBDSA-N |
| XLogP | 3.83 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |