About N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide
N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide (PubChem CID 25223761) has the molecular formula C25H27N3O
and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide |
| PubChem CID | 25223761 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1cc(Nc2ccc3c(c2)CCC3)nc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C25H27N3O/c29-25(18-7-2-1-3-8-18)28-23-16-24(27-22-12-5-4-11-21(22)23)26-20-14-13-17-9-6-10-19(17)15-20/h4-5,11-16,18H,1-3,6-10H2,(H2,26,27,28,29) |
| InChIKey | DXQZVIBFXKHZSI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide?
The IUPAC name of N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide (CID 25223761) is N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide is O=C(Nc1cc(Nc2ccc3c(c2)CCC3)nc2ccccc12)C1CCCCC1.
What is the InChIKey of N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide?
The InChIKey is DXQZVIBFXKHZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O/c29-25(18-7-2-1-3-8-18)28-23-16-24(27-22-12-5-4-11-21(22)23)26-20-14-13-17-9-6-10-19(17)15-20/h4-5,11-16,18H,1-3,6-10H2,(H2,26,27,28,29).
What are the key properties of N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide?
N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide has a molecular weight of 385.51 g/mol, XLogP of 5.99, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,3-dihydro-1H-inden-5-ylamino)quinolin-4-yl]cyclohexanecarboxamide is sourced from PubChem (CID 25223761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).