C19H18FN5O2 — CID 25223977
N-(4-fluorophenyl)-3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxamide (PubChem CID 25223977) has the molecular formula C19H18FN5O2 and a molecular weight of 367.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 25223977 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(2E)-2-[(4-methoxyphenyl)methylidene]hydrazinyl]-5-methyl-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(/C=N/Nc2n[nH]c(C)c2C(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H18FN5O2/c1-12-17(19(26)22-15-7-5-14(20)6-8-15)18(25-23-12)24-21-11-13-3-9-16(27-2)10-4-13/h3-11H,1-2H3,(H,22,26)(H2,23,24,25)/b21-11+ |
| InChIKey | JGVYVAACDQBCKG-SRZZPIQSSA-N |
| XLogP | 3.56 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|